C21H31N3O3 — CID 108952190
1-(2-ethylpiperidin-1-yl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propane-1,3-dione (PubChem CID 108952190) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propane-1,3-dione.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 108952190 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propane-1,3-dione |
| SMILES | CCC1CCCCN1C(=O)CC(=O)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C21H31N3O3/c1-3-17-6-4-5-11-24(17)21(26)16-20(25)23-14-12-22(13-15-23)18-7-9-19(27-2)10-8-18/h7-10,17H,3-6,11-16H2,1-2H3 |
| InChIKey | NVLIAQRLWJAUQV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|