C15H22N2O2 — CID 58748767
1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 58748767) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58748767 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-15(18)17-10-4-9-16(11-12-17)13-5-7-14(19-2)8-6-13/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | MYVLGEWLJNOYCS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|