C27H30N2O3 — CID 55918533
2-benzhydryloxy-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 55918533) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-benzhydryloxy-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-benzhydryloxy-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 55918533 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-benzhydryloxy-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | COc1ccc(N2CCCN(C(=O)COC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-31-25-15-13-24(14-16-25)28-17-8-18-29(20-19-28)26(30)21-32-27(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-7,9-16,27H,8,17-21H2,1H3 |
| InChIKey | SPWYDSOAKGNWBO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|