C20H22Cl2N2O2 — CID 55917762
2-(2,6-dichlorophenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 55917762) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(2,6-dichlorophenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 55917762 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | COc1ccc(N2CCCN(C(=O)Cc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-26-16-8-6-15(7-9-16)23-10-3-11-24(13-12-23)20(25)14-17-18(21)4-2-5-19(17)22/h2,4-9H,3,10-14H2,1H3 |
| InChIKey | BHMNGPNHJWDZQG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|