C24H30ClFN4O2 — CID 46807626
2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 46807626) has the molecular formula C24H30ClFN4O2 and a molecular weight of 460.98 g/mol. Its IUPAC name is 2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46807626 |
| Molecular Formula | C24H30ClFN4O2 |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CN3CCN(Cc4c(F)cccc4Cl)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H30ClFN4O2/c1-32-20-7-5-19(6-8-20)29-13-15-30(16-14-29)24(31)18-28-11-9-27(10-12-28)17-21-22(25)3-2-4-23(21)26/h2-8H,9-18H2,1H3 |
| InChIKey | XEEWYEQACVKPMQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|