C25H34N4O2 — CID 46514228
2-(4-benzyl-1,4-diazepan-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 46514228) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-benzyl-1,4-diazepan-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46514228 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-(4-benzyl-1,4-diazepan-1-yl)-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CN3CCCN(Cc4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H34N4O2/c1-31-24-10-8-23(9-11-24)28-16-18-29(19-17-28)25(30)21-27-13-5-12-26(14-15-27)20-22-6-3-2-4-7-22/h2-4,6-11H,5,12-21H2,1H3 |
| InChIKey | SKTZGBYZWILXFA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|