C29H30Cl2N4O2 — CID 25126504
4-[4-[2-(2,6-dichlorophenyl)acetyl]piperazin-1-yl]-N-(3-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 25126504) has the molecular formula C29H30Cl2N4O2 and a molecular weight of 537.49 g/mol. Its IUPAC name is 4-[4-[2-(2,6-dichlorophenyl)acetyl]piperazin-1-yl]-N-(3-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-[4-[2-(2,6-dichlorophenyl)acetyl]piperazin-1-yl]-N-(3-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 25126504 |
| Molecular Formula | C29H30Cl2N4O2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 4-[4-[2-(2,6-dichlorophenyl)acetyl]piperazin-1-yl]-N-(3-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCCC2)c1)c1ccc(N2CCN(C(=O)Cc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C29H30Cl2N4O2/c30-26-7-4-8-27(31)25(26)20-28(36)35-17-15-34(16-18-35)23-11-9-21(10-12-23)29(37)32-22-5-3-6-24(19-22)33-13-1-2-14-33/h3-12,19H,1-2,13-18,20H2,(H,32,37) |
| InChIKey | JLLFTWBOYKVBAC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|