C27H30N2O2 — CID 55919041
1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 55919041) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 55919041 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | COc1ccc(N2CCCN(C(=O)CC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H30N2O2/c1-31-25-15-13-24(14-16-25)28-17-8-18-29(20-19-28)27(30)21-26(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-7,9-16,26H,8,17-21H2,1H3 |
| InChIKey | IOYPNDVRHAPOPF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|