C24H32N2O3 — CID 55918427
2-(2-butan-2-ylphenoxy)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 55918427) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(2-butan-2-ylphenoxy)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 55918427 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CCC(C)c1ccccc1OCC(=O)N1CCCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C24H32N2O3/c1-4-19(2)22-8-5-6-9-23(22)29-18-24(27)26-15-7-14-25(16-17-26)20-10-12-21(28-3)13-11-20/h5-6,8-13,19H,4,7,14-18H2,1-3H3 |
| InChIKey | ILUGQICLUJNIAO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|