C25H30N2O4 — CID 7405503
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 7405503) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7405503 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)C3(c4ccccc4)CCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-30-22-11-9-21(10-12-22)26-15-17-27(18-16-26)23(28)19-31-24(29)25(13-5-6-14-25)20-7-3-2-4-8-20/h2-4,7-12H,5-6,13-19H2,1H3 |
| InChIKey | QXJRPJXUDRKWKX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|