C18H20N2O5 — CID 7378693
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] furan-2-carboxylate (PubChem CID 7378693) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 7378693 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] furan-2-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C18H20N2O5/c1-23-15-6-4-14(5-7-15)19-8-10-20(11-9-19)17(21)13-25-18(22)16-3-2-12-24-16/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | ZCMOXVBJFAUGET-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|