C24H25N3O4 — CID 7603625
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-pyrrol-1-ylbenzoate (PubChem CID 7603625) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-pyrrol-1-ylbenzoate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 7603625 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 3-pyrrol-1-ylbenzoate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)c3cccc(-n4cccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-30-22-9-7-20(8-10-22)26-13-15-27(16-14-26)23(28)18-31-24(29)19-5-4-6-21(17-19)25-11-2-3-12-25/h2-12,17H,13-16,18H2,1H3 |
| InChIKey | YVTKKBLUVFIUND-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|