C22H26N2O6 — CID 7260771
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2,3-dimethoxybenzoate (PubChem CID 7260771) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2,3-dimethoxybenzoate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 7260771 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 2,3-dimethoxybenzoate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)c3cccc(OC)c3OC)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O6/c1-27-17-9-7-16(8-10-17)23-11-13-24(14-12-23)20(25)15-30-22(26)18-5-4-6-19(28-2)21(18)29-3/h4-10H,11-15H2,1-3H3 |
| InChIKey | MUZGVGFZBOAEDE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|