C19H21N3O4 — CID 9045580
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate (PubChem CID 9045580) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 9045580 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O4/c1-25-17-6-4-16(5-7-17)21-9-11-22(12-10-21)18(23)14-26-19(24)15-3-2-8-20-13-15/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | FLYDLVIASSMJNH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|