C14H19N3O4 — CID 23802850
[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate (PubChem CID 23802850) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is [2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate.
| Compound Name | [2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 23802850 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl] pyridine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(CCO)CC1)c1cccnc1 |
| InChI | InChI=1S/C14H19N3O4/c18-9-8-16-4-6-17(7-5-16)13(19)11-21-14(20)12-2-1-3-15-10-12/h1-3,10,18H,4-9,11H2 |
| InChIKey | STSWBNJOHVGCEJ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |