About 2-oxopropyl pyridine-3-carboxylate
2-oxopropyl pyridine-3-carboxylate (PubChem CID 69192363) has the molecular formula C9H9NO3
and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-oxopropyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-oxopropyl pyridine-3-carboxylate |
| PubChem CID | 69192363 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2-oxopropyl pyridine-3-carboxylate |
| SMILES | CC(=O)COC(=O)c1cccnc1 |
| InChI | InChI=1S/C9H9NO3/c1-7(11)6-13-9(12)8-3-2-4-10-5-8/h2-5H,6H2,1H3 |
| InChIKey | KIJMUPPLWOFONB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-oxopropyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl pyridine-3-carboxylate?
The IUPAC name of 2-oxopropyl pyridine-3-carboxylate (CID 69192363) is 2-oxopropyl pyridine-3-carboxylate.
What is the SMILES notation for 2-oxopropyl pyridine-3-carboxylate?
The canonical SMILES for 2-oxopropyl pyridine-3-carboxylate is CC(=O)COC(=O)c1cccnc1.
What is the InChIKey of 2-oxopropyl pyridine-3-carboxylate?
The InChIKey is KIJMUPPLWOFONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-7(11)6-13-9(12)8-3-2-4-10-5-8/h2-5H,6H2,1H3.
What are the key properties of 2-oxopropyl pyridine-3-carboxylate?
2-oxopropyl pyridine-3-carboxylate has a molecular weight of 179.18 g/mol, XLogP of 0.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl pyridine-3-carboxylate is sourced from PubChem (CID 69192363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).