About (3-fluoro-3-methylbutyl) pyridine-3-carboxylate
(3-fluoro-3-methylbutyl) pyridine-3-carboxylate (PubChem CID 146343265) has the molecular formula C11H14FNO2
and a molecular weight of 211.24 g/mol. Its IUPAC name is (3-fluoro-3-methylbutyl) pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (3-fluoro-3-methylbutyl) pyridine-3-carboxylate |
| PubChem CID | 146343265 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (3-fluoro-3-methylbutyl) pyridine-3-carboxylate |
| SMILES | CC(C)(F)CCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C11H14FNO2/c1-11(2,12)5-7-15-10(14)9-4-3-6-13-8-9/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | DALWPZYNRQUVEZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-fluoro-3-methylbutyl) pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-3-methylbutyl) pyridine-3-carboxylate?
The IUPAC name of (3-fluoro-3-methylbutyl) pyridine-3-carboxylate (CID 146343265) is (3-fluoro-3-methylbutyl) pyridine-3-carboxylate.
What is the SMILES notation for (3-fluoro-3-methylbutyl) pyridine-3-carboxylate?
The canonical SMILES for (3-fluoro-3-methylbutyl) pyridine-3-carboxylate is CC(C)(F)CCOC(=O)c1cccnc1.
What is the InChIKey of (3-fluoro-3-methylbutyl) pyridine-3-carboxylate?
The InChIKey is DALWPZYNRQUVEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO2/c1-11(2,12)5-7-15-10(14)9-4-3-6-13-8-9/h3-4,6,8H,5,7H2,1-2H3.
What are the key properties of (3-fluoro-3-methylbutyl) pyridine-3-carboxylate?
(3-fluoro-3-methylbutyl) pyridine-3-carboxylate has a molecular weight of 211.24 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-3-methylbutyl) pyridine-3-carboxylate is sourced from PubChem (CID 146343265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).