C28H31N3O6 — CID 3588
View drug profile → hepronicate2,2-bis(pyridine-3-carbonyloxymethyl)octyl pyridine-3-carboxylate (PubChem CID 3588) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2,2-bis(pyridine-3-carbonyloxymethyl)octyl pyridine-3-carboxylate.
| Compound Name | 2,2-bis(pyridine-3-carbonyloxymethyl)octyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3588 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 2,2-bis(pyridine-3-carbonyloxymethyl)octyl pyridine-3-carboxylate |
| SMILES | CCCCCCC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 |
| InChI | InChI=1S/C28H31N3O6/c1-2-3-4-5-12-28(19-35-25(32)22-9-6-13-29-16-22,20-36-26(33)23-10-7-14-30-17-23)21-37-27(34)24-11-8-15-31-18-24/h6-11,13-18H,2-5,12,19-21H2,1H3 |
| InChIKey | GUIBJJJLGSYNKE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|