About azane;pyridine-3-carbonyl pyridine-3-carboxylate
azane;pyridine-3-carbonyl pyridine-3-carboxylate (PubChem CID 174932870) has the molecular formula C12H11N3O3
and a molecular weight of 245.24 g/mol. Its IUPAC name is azane;pyridine-3-carbonyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | azane;pyridine-3-carbonyl pyridine-3-carboxylate |
| PubChem CID | 174932870 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | azane;pyridine-3-carbonyl pyridine-3-carboxylate |
| SMILES | N.O=C(OC(=O)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C12H8N2O3.H3N/c15-11(9-3-1-5-13-7-9)17-12(16)10-4-2-6-14-8-10;/h1-8H;1H3 |
| InChIKey | ALMMTCQZRYZNON-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;pyridine-3-carbonyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;pyridine-3-carbonyl pyridine-3-carboxylate?
The IUPAC name of azane;pyridine-3-carbonyl pyridine-3-carboxylate (CID 174932870) is azane;pyridine-3-carbonyl pyridine-3-carboxylate.
What is the SMILES notation for azane;pyridine-3-carbonyl pyridine-3-carboxylate?
The canonical SMILES for azane;pyridine-3-carbonyl pyridine-3-carboxylate is N.O=C(OC(=O)c1cccnc1)c1cccnc1.
What is the InChIKey of azane;pyridine-3-carbonyl pyridine-3-carboxylate?
The InChIKey is ALMMTCQZRYZNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3.H3N/c15-11(9-3-1-5-13-7-9)17-12(16)10-4-2-6-14-8-10;/h1-8H;1H3.
What are the key properties of azane;pyridine-3-carbonyl pyridine-3-carboxylate?
azane;pyridine-3-carbonyl pyridine-3-carboxylate has a molecular weight of 245.24 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;pyridine-3-carbonyl pyridine-3-carboxylate is sourced from PubChem (CID 174932870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).