About pyridine-3-carbonyl pyrimidine-5-carboxylate
pyridine-3-carbonyl pyrimidine-5-carboxylate (PubChem CID 144515193) has the molecular formula C11H7N3O3
and a molecular weight of 229.20 g/mol. Its IUPAC name is pyridine-3-carbonyl pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | pyridine-3-carbonyl pyrimidine-5-carboxylate |
| PubChem CID | 144515193 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | pyridine-3-carbonyl pyrimidine-5-carboxylate |
| SMILES | O=C(OC(=O)c1cncnc1)c1cccnc1 |
| InChI | InChI=1S/C11H7N3O3/c15-10(8-2-1-3-12-4-8)17-11(16)9-5-13-7-14-6-9/h1-7H |
| InChIKey | MJNVSTSALQQYRQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pyridine-3-carbonyl pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-3-carbonyl pyrimidine-5-carboxylate?
The IUPAC name of pyridine-3-carbonyl pyrimidine-5-carboxylate (CID 144515193) is pyridine-3-carbonyl pyrimidine-5-carboxylate.
What is the SMILES notation for pyridine-3-carbonyl pyrimidine-5-carboxylate?
The canonical SMILES for pyridine-3-carbonyl pyrimidine-5-carboxylate is O=C(OC(=O)c1cncnc1)c1cccnc1.
What is the InChIKey of pyridine-3-carbonyl pyrimidine-5-carboxylate?
The InChIKey is MJNVSTSALQQYRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O3/c15-10(8-2-1-3-12-4-8)17-11(16)9-5-13-7-14-6-9/h1-7H.
What are the key properties of pyridine-3-carbonyl pyrimidine-5-carboxylate?
pyridine-3-carbonyl pyrimidine-5-carboxylate has a molecular weight of 229.20 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-3-carbonyl pyrimidine-5-carboxylate is sourced from PubChem (CID 144515193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).