About methylsulfanyl pyridine-3-carboxylate
methylsulfanyl pyridine-3-carboxylate (PubChem CID 143338769) has the molecular formula C7H7NO2S
and a molecular weight of 169.20 g/mol. Its IUPAC name is methylsulfanyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methylsulfanyl pyridine-3-carboxylate |
| PubChem CID | 143338769 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | methylsulfanyl pyridine-3-carboxylate |
| SMILES | CSOC(=O)c1cccnc1 |
| InChI | InChI=1S/C7H7NO2S/c1-11-10-7(9)6-3-2-4-8-5-6/h2-5H,1H3 |
| InChIKey | SVDVTVCTIGGNFQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanyl pyridine-3-carboxylate?
The IUPAC name of methylsulfanyl pyridine-3-carboxylate (CID 143338769) is methylsulfanyl pyridine-3-carboxylate.
What is the SMILES notation for methylsulfanyl pyridine-3-carboxylate?
The canonical SMILES for methylsulfanyl pyridine-3-carboxylate is CSOC(=O)c1cccnc1.
What is the InChIKey of methylsulfanyl pyridine-3-carboxylate?
The InChIKey is SVDVTVCTIGGNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S/c1-11-10-7(9)6-3-2-4-8-5-6/h2-5H,1H3.
What are the key properties of methylsulfanyl pyridine-3-carboxylate?
methylsulfanyl pyridine-3-carboxylate has a molecular weight of 169.20 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanyl pyridine-3-carboxylate is sourced from PubChem (CID 143338769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).