About pyrrol-1-yl pyridine-3-carboxylate;hydrochloride
pyrrol-1-yl pyridine-3-carboxylate;hydrochloride (PubChem CID 174946460) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is pyrrol-1-yl pyridine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | pyrrol-1-yl pyridine-3-carboxylate;hydrochloride |
| PubChem CID | 174946460 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | pyrrol-1-yl pyridine-3-carboxylate;hydrochloride |
| SMILES | Cl.O=C(On1cccc1)c1cccnc1 |
| InChI | InChI=1S/C10H8N2O2.ClH/c13-10(9-4-3-5-11-8-9)14-12-6-1-2-7-12;/h1-8H;1H |
| InChIKey | PJKMMTHXUJIMGF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrol-1-yl pyridine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrol-1-yl pyridine-3-carboxylate;hydrochloride?
The IUPAC name of pyrrol-1-yl pyridine-3-carboxylate;hydrochloride (CID 174946460) is pyrrol-1-yl pyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for pyrrol-1-yl pyridine-3-carboxylate;hydrochloride?
The canonical SMILES for pyrrol-1-yl pyridine-3-carboxylate;hydrochloride is Cl.O=C(On1cccc1)c1cccnc1.
What is the InChIKey of pyrrol-1-yl pyridine-3-carboxylate;hydrochloride?
The InChIKey is PJKMMTHXUJIMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.ClH/c13-10(9-4-3-5-11-8-9)14-12-6-1-2-7-12;/h1-8H;1H.
What are the key properties of pyrrol-1-yl pyridine-3-carboxylate;hydrochloride?
pyrrol-1-yl pyridine-3-carboxylate;hydrochloride has a molecular weight of 224.65 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrol-1-yl pyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 174946460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).