About azane;imidazol-1-yl pyridine-3-carboxylate
azane;imidazol-1-yl pyridine-3-carboxylate (PubChem CID 175403064) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is azane;imidazol-1-yl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | azane;imidazol-1-yl pyridine-3-carboxylate |
| PubChem CID | 175403064 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | azane;imidazol-1-yl pyridine-3-carboxylate |
| SMILES | N.O=C(On1ccnc1)c1cccnc1 |
| InChI | InChI=1S/C9H7N3O2.H3N/c13-9(8-2-1-3-10-6-8)14-12-5-4-11-7-12;/h1-7H;1H3 |
| InChIKey | AATQPSFDGRIQKI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azane;imidazol-1-yl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;imidazol-1-yl pyridine-3-carboxylate?
The IUPAC name of azane;imidazol-1-yl pyridine-3-carboxylate (CID 175403064) is azane;imidazol-1-yl pyridine-3-carboxylate.
What is the SMILES notation for azane;imidazol-1-yl pyridine-3-carboxylate?
The canonical SMILES for azane;imidazol-1-yl pyridine-3-carboxylate is N.O=C(On1ccnc1)c1cccnc1.
What is the InChIKey of azane;imidazol-1-yl pyridine-3-carboxylate?
The InChIKey is AATQPSFDGRIQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2.H3N/c13-9(8-2-1-3-10-6-8)14-12-5-4-11-7-12;/h1-7H;1H3.
What are the key properties of azane;imidazol-1-yl pyridine-3-carboxylate?
azane;imidazol-1-yl pyridine-3-carboxylate has a molecular weight of 206.21 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;imidazol-1-yl pyridine-3-carboxylate is sourced from PubChem (CID 175403064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).