C22H22N4O4 — CID 23744577
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] quinoxaline-2-carboxylate (PubChem CID 23744577) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] quinoxaline-2-carboxylate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 23744577 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] quinoxaline-2-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)c3cnc4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C22H22N4O4/c1-29-17-8-6-16(7-9-17)25-10-12-26(13-11-25)21(27)15-30-22(28)20-14-23-18-4-2-3-5-19(18)24-20/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | UVPGYISTIYKNEL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|