C27H29N3O4 — CID 2672640
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 2672640) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 2672640 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)c3c4c(nc5ccccc35)CCCC4)CC2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-33-20-12-10-19(11-13-20)29-14-16-30(17-15-29)25(31)18-34-27(32)26-21-6-2-4-8-23(21)28-24-9-5-3-7-22(24)26/h2,4,6,8,10-13H,3,5,7,9,14-18H2,1H3 |
| InChIKey | LKWIZRJBWWSTOQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|