C21H19NO2 — CID 21239887
(4-methoxyphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone (PubChem CID 21239887) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (4-methoxyphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone.
| Compound Name | (4-methoxyphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone |
|---|---|
| PubChem CID | 21239887 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (4-methoxyphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone |
| SMILES | COc1ccc(C(=O)c2c3c(nc4ccccc24)CCCC3)cc1 |
| InChI | InChI=1S/C21H19NO2/c1-24-15-12-10-14(11-13-15)21(23)20-16-6-2-4-8-18(16)22-19-9-5-3-7-17(19)20/h2,4,6,8,10-13H,3,5,7,9H2,1H3 |
| InChIKey | QJUXKNCYQVSVOX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |