C22H21NO — CID 21239890
(2,5-dimethylphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone (PubChem CID 21239890) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone.
| Compound Name | (2,5-dimethylphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone |
|---|---|
| PubChem CID | 21239890 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2,5-dimethylphenyl)-(1,2,3,4-tetrahydroacridin-9-yl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)c2c3c(nc4ccccc24)CCCC3)c1 |
| InChI | InChI=1S/C22H21NO/c1-14-11-12-15(2)18(13-14)22(24)21-16-7-3-5-9-19(16)23-20-10-6-4-8-17(20)21/h3,5,7,9,11-13H,4,6,8,10H2,1-2H3 |
| InChIKey | KVQHJAPFELXZTK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |