About propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate
propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 16600366) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
Analyze propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
The IUPAC name of propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (CID 16600366) is propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
What is the SMILES notation for propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
The canonical SMILES for propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate is Cc1ccc2nc3c(c(C(=O)OC(C)C)c2c1)CCCC3.
What is the InChIKey of propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
The InChIKey is ACPGADVRIZUZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-11(2)21-18(20)17-13-6-4-5-7-15(13)19-16-9-8-12(3)10-14(16)17/h8-11H,4-7H2,1-3H3.
What are the key properties of propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate?
propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate has a molecular weight of 283.37 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate is sourced from PubChem (CID 16600366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).