7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid

C15H15NO2 — CID 752870

IUPAC7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid
SMILESCc1ccc2nc3c(c(C(=O)O)c2c1)CCCC3
InChIInChI=1S/C15H15NO2/c1-9-6-7-13-11(8-9)14(15(17)18)10-4-2-3-5-12(10)16-13/h6-8H,2-5H2,1H3,(H,17,18)
InChIKeyZLAJPSWHTFQIKE-UHFFFAOYSA-N
MW241.29 g/mol
LogP3.12
Rot. Bonds1

About 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid

7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid (PubChem CID 752870) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid.

Molecular Properties

Compound Name7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid
PubChem CID752870
Molecular FormulaC15H15NO2
Molecular Weight241.29 g/mol
Exact Mass241.11
IUPAC Name7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid
SMILESCc1ccc2nc3c(c(C(=O)O)c2c1)CCCC3
InChIInChI=1S/C15H15NO2/c1-9-6-7-13-11(8-9)14(15(17)18)10-4-2-3-5-12(10)16-13/h6-8H,2-5H2,1H3,(H,17,18)
InChIKeyZLAJPSWHTFQIKE-UHFFFAOYSA-N
XLogP3.12
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.29
LogP ≤ 53.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
The IUPAC name of 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid (CID 752870) is 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid.
What is the SMILES notation for 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
The canonical SMILES for 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid is Cc1ccc2nc3c(c(C(=O)O)c2c1)CCCC3.
What is the InChIKey of 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
The InChIKey is ZLAJPSWHTFQIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-9-6-7-13-11(8-9)14(15(17)18)10-4-2-3-5-12(10)16-13/h6-8H,2-5H2,1H3,(H,17,18).
What are the key properties of 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid?
7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid has a molecular weight of 241.29 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,2,3,4-tetrahydroacridine-9-carboxylic acid is sourced from PubChem (CID 752870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).