7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid

C13H10FNO2 — CID 865221

IUPAC7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
SMILESO=C(O)c1c2c(nc3ccc(F)cc13)CCC2
InChIInChI=1S/C13H10FNO2/c14-7-4-5-11-9(6-7)12(13(16)17)8-2-1-3-10(8)15-11/h4-6H,1-3H2,(H,16,17)
InChIKeyGQDGXIDEQRWWKN-UHFFFAOYSA-N
MW231.23 g/mol
LogP2.56
Rot. Bonds1

About 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid

7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (PubChem CID 865221) has the molecular formula C13H10FNO2 and a molecular weight of 231.23 g/mol. Its IUPAC name is 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid.

Molecular Properties

Compound Name7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
PubChem CID865221
Molecular FormulaC13H10FNO2
Molecular Weight231.23 g/mol
Exact Mass231.07
IUPAC Name7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
SMILESO=C(O)c1c2c(nc3ccc(F)cc13)CCC2
InChIInChI=1S/C13H10FNO2/c14-7-4-5-11-9(6-7)12(13(16)17)8-2-1-3-10(8)15-11/h4-6H,1-3H2,(H,16,17)
InChIKeyGQDGXIDEQRWWKN-UHFFFAOYSA-N
XLogP2.56
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.23
LogP ≤ 52.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The IUPAC name of 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (CID 865221) is 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid.
What is the SMILES notation for 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The canonical SMILES for 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid is O=C(O)c1c2c(nc3ccc(F)cc13)CCC2.
What is the InChIKey of 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
The InChIKey is GQDGXIDEQRWWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNO2/c14-7-4-5-11-9(6-7)12(13(16)17)8-2-1-3-10(8)15-11/h4-6H,1-3H2,(H,16,17).
What are the key properties of 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid?
7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid has a molecular weight of 231.23 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid is sourced from PubChem (CID 865221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).