C14H15FN2 — CID 82451478
(7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)methanamine (PubChem CID 82451478) has the molecular formula C14H15FN2 and a molecular weight of 230.29 g/mol. Its IUPAC name is (7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)methanamine.
| Compound Name | (7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)methanamine |
|---|---|
| PubChem CID | 82451478 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)methanamine |
| SMILES | NCc1c2c(nc3ccc(F)cc13)CCCC2 |
| InChI | InChI=1S/C14H15FN2/c15-9-5-6-14-11(7-9)12(8-16)10-3-1-2-4-13(10)17-14/h5-7H,1-4,8,16H2 |
| InChIKey | SHJTWCPULNUFGL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |