C13H12ClNS — CID 82451346
(7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol (PubChem CID 82451346) has the molecular formula C13H12ClNS and a molecular weight of 249.77 g/mol. Its IUPAC name is (7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol.
| Compound Name | (7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol |
|---|---|
| PubChem CID | 82451346 |
| Molecular Formula | C13H12ClNS |
| Molecular Weight | 249.77 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (7-chloro-2,3-dihydro-1H-cyclopenta[b]quinolin-9-yl)methanethiol |
| SMILES | SCc1c2c(nc3ccc(Cl)cc13)CCC2 |
| InChI | InChI=1S/C13H12ClNS/c14-8-4-5-13-10(6-8)11(7-16)9-2-1-3-12(9)15-13/h4-6,16H,1-3,7H2 |
| InChIKey | BQXXPIHHFIWOQM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|