C17H21ClN2 — CID 82451364
N-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]propan-1-amine (PubChem CID 82451364) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is N-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]propan-1-amine.
| Compound Name | N-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 82451364 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1c2c(nc3ccc(Cl)cc13)CCCC2 |
| InChI | InChI=1S/C17H21ClN2/c1-2-9-19-11-15-13-5-3-4-6-16(13)20-17-8-7-12(18)10-14(15)17/h7-8,10,19H,2-6,9,11H2,1H3 |
| InChIKey | DMMLEPYPPTYLTN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|