C14H15ClN2 — CID 62202376
7-chloro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 62202376) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 7-chloro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 7-chloro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 62202376 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 7-chloro-N-methyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CNc1c2c(nc3ccc(Cl)cc13)CCCC2 |
| InChI | InChI=1S/C14H15ClN2/c1-16-14-10-4-2-3-5-12(10)17-13-7-6-9(15)8-11(13)14/h6-8H,2-5H2,1H3,(H,16,17) |
| InChIKey | CHAAYPHSNGBWAK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |