C24H34ClN3O2 — CID 123212163
10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl carbamate (PubChem CID 123212163) has the molecular formula C24H34ClN3O2 and a molecular weight of 432.01 g/mol. Its IUPAC name is 10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl carbamate.
| Compound Name | 10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl carbamate |
|---|---|
| PubChem CID | 123212163 |
| Molecular Formula | C24H34ClN3O2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 10-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl carbamate |
| SMILES | NC(=O)OCCCCCCCCCCNc1c2c(nc3ccc(Cl)cc13)CCCC2 |
| InChI | InChI=1S/C24H34ClN3O2/c25-18-13-14-22-20(17-18)23(19-11-7-8-12-21(19)28-22)27-15-9-5-3-1-2-4-6-10-16-30-24(26)29/h13-14,17H,1-12,15-16H2,(H2,26,29)(H,27,28) |
| InChIKey | BTLGTDPKWOPBSN-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|