C16H17N2O3- — CID 7138240
9-(3-hydroxypropylamino)-2,3-dihydro-1H-cyclopenta[b]quinoline-7-carboxylate (PubChem CID 7138240) has the molecular formula C16H17N2O3- and a molecular weight of 285.32 g/mol. Its IUPAC name is 9-(3-hydroxypropylamino)-2,3-dihydro-1H-cyclopenta[b]quinoline-7-carboxylate.
| Compound Name | 9-(3-hydroxypropylamino)-2,3-dihydro-1H-cyclopenta[b]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 7138240 |
| Molecular Formula | C16H17N2O3- |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 9-(3-hydroxypropylamino)-2,3-dihydro-1H-cyclopenta[b]quinoline-7-carboxylate |
| SMILES | O=C([O-])c1ccc2nc3c(c(NCCCO)c2c1)CCC3 |
| InChI | InChI=1S/C16H18N2O3/c19-8-2-7-17-15-11-3-1-4-13(11)18-14-6-5-10(16(20)21)9-12(14)15/h5-6,9,19H,1-4,7-8H2,(H,17,18)(H,20,21)/p-1 |
| InChIKey | YNXABGVLQCEAJK-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|