C25H28N4O2 — CID 175777015
1-[4-[9-(3-hydroxypropylamino)-5,6,7,8-tetrahydroacridin-3-yl]-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 175777015) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-[4-[9-(3-hydroxypropylamino)-5,6,7,8-tetrahydroacridin-3-yl]-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[4-[9-(3-hydroxypropylamino)-5,6,7,8-tetrahydroacridin-3-yl]-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 175777015 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-[4-[9-(3-hydroxypropylamino)-5,6,7,8-tetrahydroacridin-3-yl]-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(c2cc(-c3ccc4c(NCCCO)c5c(nc4c3)CCCC5)ccn2)CC1 |
| InChI | InChI=1S/C25H28N4O2/c26-24(31)25(9-10-25)22-15-17(8-12-27-22)16-6-7-19-21(14-16)29-20-5-2-1-4-18(20)23(19)28-11-3-13-30/h6-8,12,14-15,30H,1-5,9-11,13H2,(H2,26,31)(H,28,29) |
| InChIKey | VNPZVXVVHVOJBI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|