C21H30N4O — CID 10959176
N-(3-aminopropyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]acetamide (PubChem CID 10959176) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]acetamide.
| Compound Name | N-(3-aminopropyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]acetamide |
|---|---|
| PubChem CID | 10959176 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N-(3-aminopropyl)-N-[3-(1,2,3,4-tetrahydroacridin-9-ylamino)propyl]acetamide |
| SMILES | CC(=O)N(CCCN)CCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C21H30N4O/c1-16(26)25(14-6-12-22)15-7-13-23-21-17-8-2-4-10-19(17)24-20-11-5-3-9-18(20)21/h2,4,8,10H,3,5-7,9,11-15,22H2,1H3,(H,23,24) |
| InChIKey | GDLIFRVGCIDUBB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|