C22H31N3O — CID 24799949
2,2-dimethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]propanamide (PubChem CID 24799949) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]propanamide |
|---|---|
| PubChem CID | 24799949 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 2,2-dimethyl-N-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C22H31N3O/c1-22(2,3)21(26)24-15-9-8-14-23-20-16-10-4-6-12-18(16)25-19-13-7-5-11-17(19)20/h4,6,10,12H,5,7-9,11,13-15H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | NDNHQHDGXMCKAU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|