C21H30N2 — CID 10018304
N-octyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 10018304) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is N-octyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-octyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 10018304 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | N-octyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C21H30N2/c1-2-3-4-5-6-11-16-22-21-17-12-7-9-14-19(17)23-20-15-10-8-13-18(20)21/h7,9,12,14H,2-6,8,10-11,13,15-16H2,1H3,(H,22,23) |
| InChIKey | YBNDUUUQKSTMNR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|