C19H27ClN2 — CID 24837218
N-butyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-amine;hydrochloride (PubChem CID 24837218) has the molecular formula C19H27ClN2 and a molecular weight of 318.89 g/mol. Its IUPAC name is N-butyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-amine;hydrochloride.
| Compound Name | N-butyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-amine;hydrochloride |
|---|---|
| PubChem CID | 24837218 |
| Molecular Formula | C19H27ClN2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-butyl-6,7,8,9,10,11-hexahydrocycloocta[b]quinolin-12-amine;hydrochloride |
| SMILES | CCCCNc1c2c(nc3ccccc13)CCCCCC2.Cl |
| InChI | InChI=1S/C19H26N2.ClH/c1-2-3-14-20-19-15-10-6-4-5-7-12-17(15)21-18-13-9-8-11-16(18)19;/h8-9,11,13H,2-7,10,12,14H2,1H3,(H,20,21);1H |
| InChIKey | FDZAGLMHYOSROU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|