C20H30ClN3 — CID 45265092
N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine;hydrochloride (PubChem CID 45265092) has the molecular formula C20H30ClN3 and a molecular weight of 347.93 g/mol. Its IUPAC name is N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine;hydrochloride.
| Compound Name | N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine;hydrochloride |
|---|---|
| PubChem CID | 45265092 |
| Molecular Formula | C20H30ClN3 |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine;hydrochloride |
| SMILES | Cl.NCCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H29N3.ClH/c21-14-8-2-1-3-9-15-22-20-16-10-4-6-12-18(16)23-19-13-7-5-11-17(19)20;/h4,6,10,12H,1-3,5,7-9,11,13-15,21H2,(H,22,23);1H |
| InChIKey | JUIPZPOTRODEHD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|