C17H23N3S2 — CID 155591780
N-[2-(2-aminoethyldisulfanyl)ethyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 155591780) has the molecular formula C17H23N3S2 and a molecular weight of 333.53 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 155591780 |
| Molecular Formula | C17H23N3S2 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | NCCSSCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C17H23N3S2/c18-9-11-21-22-12-10-19-17-13-5-1-3-7-15(13)20-16-8-4-2-6-14(16)17/h1,3,5,7H,2,4,6,8-12,18H2,(H,19,20) |
| InChIKey | XUTCPPOEVKVFDX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|