C18H23N3O2 — CID 118035689
4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylcarbamic acid (PubChem CID 118035689) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylcarbamic acid.
| Compound Name | 4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylcarbamic acid |
|---|---|
| PubChem CID | 118035689 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylcarbamic acid |
| SMILES | O=C(O)NCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C18H23N3O2/c22-18(23)20-12-6-5-11-19-17-13-7-1-3-9-15(13)21-16-10-4-2-8-14(16)17/h1,3,7,9,20H,2,4-6,8,10-12H2,(H,19,21)(H,22,23) |
| InChIKey | GTXQHTOUQLKXLN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|