C20H26N4O4 — CID 24800295
[3-oxo-3-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]propyl] nitrate (PubChem CID 24800295) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is [3-oxo-3-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]propyl] nitrate.
| Compound Name | [3-oxo-3-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]propyl] nitrate |
|---|---|
| PubChem CID | 24800295 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | [3-oxo-3-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butylamino]propyl] nitrate |
| SMILES | O=C(CCO[N+](=O)[O-])NCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H26N4O4/c25-19(11-14-28-24(26)27)21-12-5-6-13-22-20-15-7-1-3-9-17(15)23-18-10-4-2-8-16(18)20/h1,3,7,9H,2,4-6,8,10-14H2,(H,21,25)(H,22,23) |
| InChIKey | FZBSIZBRWNKKOD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|