C20H27N3O2 — CID 86293041
N-hydroxy-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptanamide (PubChem CID 86293041) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-hydroxy-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptanamide.
| Compound Name | N-hydroxy-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptanamide |
|---|---|
| PubChem CID | 86293041 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-hydroxy-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptanamide |
| SMILES | O=C(CCCCCCNc1c2c(nc3ccccc13)CCCC2)NO |
| InChI | InChI=1S/C20H27N3O2/c24-19(23-25)13-3-1-2-8-14-21-20-15-9-4-6-11-17(15)22-18-12-7-5-10-16(18)20/h4,6,9,11,25H,1-3,5,7-8,10,12-14H2,(H,21,22)(H,23,24) |
| InChIKey | LCXNAFQXJXPPHR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|