C20H25N3O3 — CID 86293233
N-[6-(hydroxyamino)-6-oxohexyl]-1,2,3,4-tetrahydroacridine-9-carboxamide (PubChem CID 86293233) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[6-(hydroxyamino)-6-oxohexyl]-1,2,3,4-tetrahydroacridine-9-carboxamide.
| Compound Name | N-[6-(hydroxyamino)-6-oxohexyl]-1,2,3,4-tetrahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 86293233 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[6-(hydroxyamino)-6-oxohexyl]-1,2,3,4-tetrahydroacridine-9-carboxamide |
| SMILES | O=C(CCCCCNC(=O)c1c2c(nc3ccccc13)CCCC2)NO |
| InChI | InChI=1S/C20H25N3O3/c24-18(23-26)12-2-1-7-13-21-20(25)19-14-8-3-5-10-16(14)22-17-11-6-4-9-15(17)19/h3,5,8,10,26H,1-2,4,6-7,9,11-13H2,(H,21,25)(H,23,24) |
| InChIKey | BKCWSLDVQYMWPR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|