C19H22N2O3 — CID 51126378
methyl 5-(2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbonylamino)pentanoate (PubChem CID 51126378) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl 5-(2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbonylamino)pentanoate.
| Compound Name | methyl 5-(2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 51126378 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | methyl 5-(2,3-dihydro-1H-cyclopenta[b]quinoline-9-carbonylamino)pentanoate |
| SMILES | COC(=O)CCCCNC(=O)c1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C19H22N2O3/c1-24-17(22)11-4-5-12-20-19(23)18-13-7-2-3-9-15(13)21-16-10-6-8-14(16)18/h2-3,7,9H,4-6,8,10-12H2,1H3,(H,20,23) |
| InChIKey | CCCNKGZTYNUXLI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|