C27H32N4O2 — CID 46541470
N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide (PubChem CID 46541470) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide.
| Compound Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 46541470 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)c3c4c(nc5ccccc35)CCC4)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-33-21-12-10-20(11-13-21)31-18-16-30(17-19-31)15-5-14-28-27(32)26-22-6-2-3-8-24(22)29-25-9-4-7-23(25)26/h2-3,6,8,10-13H,4-5,7,9,14-19H2,1H3,(H,28,32) |
| InChIKey | QIJZLFJADKSVDQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|