C29H34N4O3 — CID 155666132
4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzamide (PubChem CID 155666132) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzamide.
| Compound Name | 4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzamide |
|---|---|
| PubChem CID | 155666132 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NCCCCCCNc2c3c(nc4ccccc24)CCCC3)cc1)NO |
| InChI | InChI=1S/C29H34N4O3/c34-27(33-36)18-15-21-13-16-22(17-14-21)29(35)31-20-8-2-1-7-19-30-28-23-9-3-5-11-25(23)32-26-12-6-4-10-24(26)28/h3,5,9,11,13-18,36H,1-2,4,6-8,10,12,19-20H2,(H,30,32)(H,31,35)(H,33,34)/b18-15+ |
| InChIKey | BHKVZHLSORGHLO-OBGWFSINSA-N |
| XLogP | 5.03 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|